Questions and tasks in the category > 1145

Environmental Sciences, 28.02.2020 12:10, rudru10

1parsec is equal to how many light year...

Chemistry, 28.02.2020 12:10, suchitrapawan

Ascientist would most likely need to update her model when it...

English, 28.02.2020 12:10, meandart

How can we keep our stomach healthy...

Math, 28.02.2020 12:10, rajveer8591

Find the three consecutive terms of g.p. whose sum is 13 and sum of whose squares is 91....

Science, 28.02.2020 12:10, Unicorn1523

What devices ll u use to share with others the knowledge that you have?...

Science, 28.02.2020 12:10, tegery

How are thermometer used in deserts different than those used at poles...

Computer Science, 28.02.2020 12:10, priyansh86

What is plagiarism ? how can you avoid it ? content quality required no spamming...

Geography, 28.02.2020 12:10, vishal7056

What is the world's least densely populated country?...

Physics, 28.02.2020 12:10, sana1234544

At what speed the earth is rotating/spinning? also tell me what happen if that speed get double?...

Math, 28.02.2020 12:10, vishal7056

Q2. is greater: (– 9 + 7) x 100 or (9 – 7) x 100?...

Science, 28.02.2020 12:10, kumarivishakha118

Afarmer grows wheat year after year. he finds that the yield becomes low. give one appropriate reason for it....

Chemistry, 28.02.2020 12:10, laejur

Ph of a solution is 2 and ph of another solution is 6 then find the net ph of the soultion...

Math, 28.02.2020 12:10, jack626259

(2x -3) is a factor of x + 2x^3 -9x^2 +12...

Chemistry, 28.02.2020 12:10, M015

What nucleus of atom contains ? a. protons b. electrons c. electrons and protons d. protons and neutrons...

Chemistry, 28.02.2020 12:10, faraaz62

What happens when hcl is poure on al foil...

Math, 28.02.2020 12:10, Firdaus17f

Plz hepl its olivia walked 2 2/5 km in 2/3 hour ryan walked 4 1/2 km in 1 1/2 hours. who walked faster,? how many times as fast did the...

Biology, 28.02.2020 12:10, siya1472006

Distinguish between a biological and biological nitrogen fixation...

Geography, 28.02.2020 12:10, jack626259

Find the odd one out sri lanka maldives thailand singapore...

Math, 28.02.2020 12:10, chennupatitanuja

Resolve in factors : - 9/64x - 1/144y...

Math, 28.02.2020 12:10, shashidarshanbiradar

Simplify 25×p^-8/5^-2×100×p^5where p is not equal to 0...

History, 28.02.2020 12:10, madhavirani24

Give reason for the establishment of the mohammedan anglo-oriental defence association in 1893...

English, 28.02.2020 12:10, lighy6155

Food security poster and also pictures...

Math, 28.02.2020 12:10, eka85

Math, 28.02.2020 12:10, veer1277gmailcom

If the angle if elevation of a tower from a distance of 100 m from its foot is 60 find the height of the tower...

Geography, 28.02.2020 12:10, alikarki2580

Reason why is upper course has big soil particles but lower course has small particles? ?...

Sociology, 28.02.2020 12:10, tegery

David cup is associated with a. football b. hockey c. tennis d. cricket...

Math, 28.02.2020 12:10, karanrai123

Find the mulyiplicative inverse of 1-i...

English, 28.02.2020 12:10, Firdaus17f

What is the other name of anand bharati...

English, 28.02.2020 12:10, gyanendra19

He said, " i am feeling giddy ". change into indirect speech...

Biology, 28.02.2020 12:10, Firdaus17f

How many meiotic divisions required to make 101 seeds...

Math, 28.02.2020 12:10, jack626259

Using the digits 0 7 8and 6 find the sum of four-digit numbers that can be formed without repetition...

Science, 28.02.2020 12:10, kokaamy

Name three endamic species fond in india...

Chemistry, 28.02.2020 12:10, hiraji

Equation correctly represents the combustion of butane c4h10 in excess oxygen?...

World Languages, 28.02.2020 12:10, piyush872850

Unidades de mediciã³n que se utilizan en la termodinã¡mica...

English, 28.02.2020 12:10, Firdaus17f

What is the significance of shehnai...

Math, 28.02.2020 12:10, suchitrapawan

Two students start to beat the drums simultaneously, but at different intervals of 10 seconds and 12 seconds respectively.what is the minimum time aft...

Physics, 28.02.2020 12:10, M015

Difference between magnetic fields produced by solenoid and toroid...

Physics, 28.02.2020 12:10, Mannubhalla93

Three holes a b and c and made in an empty can at different levels one over the other as shown in the figure are closed with an adhesive tape the can...

Chemistry, 28.02.2020 12:10, success124

What is unsaturated hydrocarbons? describe its types...

English, 28.02.2020 12:10, jack626259

***change the narration*** 1. "tell, me a story, mother," leela said. 2. "sir, do you want a servant? " sidda asked mr. sivasanker....

Geography, 28.02.2020 12:10, sahini99

Prepare a questionnaire for a visit to a military office...

Social Sciences, 28.02.2020 12:10, shad007

Discuss the uses of modern farming for yield (5 marks question, 5 points )...

Environmental Sciences, 28.02.2020 12:10, mathmatics9898

Why is river water pollution considerd as a significant danger?...

Math, 28.02.2020 12:10, shashidarshanbiradar

What are the powers of 3 that are in the range 3 through 1,000?...

Chemistry, 28.02.2020 12:10, siya1472006

Potassium dichromate reacts with potassium iodide in presence of sulphuric acid...

Social Sciences, 28.02.2020 12:10, piyush872850

How do we study society in 500 words...

Biology, 28.02.2020 12:10, dishita204

Why does meiosis and mitotic division take place in germ cells?...

Math, 28.02.2020 12:10, siya1472006

The roots of the quadratic equation are real and equal,find k. 3y^2+ky+12=0...

Chemistry, 28.02.2020 12:10, nitesh3786

Balance equation for the following sodium metal reacts with water to produce aqueous sodium hydroxide and hydrogen gas...

History, 28.02.2020 12:10, jack626259

Where india's largest musuem is located...

English, 28.02.2020 12:10, Firdaus17f

Write a letter to the editor of the times of india...

English, 28.02.2020 12:10, atharvakarawade1

Write a letter to the district magistrate of ballia towards the contamination of water in ganga...

Math, 28.02.2020 12:10, Mannubhalla93

Find the fourth proportional 28, 32, 17...

Math, 28.02.2020 12:10, Firdaus17f

The hcf and lcm of two numbers are given by 5 and 100 respectively.if first number divided by 5 it give a quotient 4...

Biology, 28.02.2020 12:10, malikfaiz24

Why the human brain is more advance than other animals brain...

English, 28.02.2020 12:10, renukatumane109

5lines on cleanliness for teachers speech in assembly...

Math, 28.02.2020 12:10, jivan99

The sum of three number is 98. of the ratio between 1st and 2nd be 2: 3 and that between 2nd and be 5: 8, then find the 2nd no....

History, 28.02.2020 12:10, garganjali1985

Two striking features of egypt ci cvilisation...

English, 28.02.2020 12:10, Sowdamini

Write a email to the education minister of your state to ensure that all the below fourteen years are able to get school education...

Chemistry, 28.02.2020 12:10, renukatumane109

Why ia a small amount of acid added to water before its electrolytical decomposition?...

Chemistry, 28.02.2020 12:10, akshat8712

The lead storage battery uses the reaction: pb(s)+pbo2(s)+2h+(aq)+2hso−4(aq)→2pbso4(s)+2h2o(l)calculate δg for reaction on a cold winter's day (10 ∘f...

Geography, 28.02.2020 12:10, dhvani6272

Discribe how a fast flowing river can become a natural resources...

Economy, 28.02.2020 12:10, jivan99

What are the main reason for employment is important...

Biology, 28.02.2020 12:10, rehnamohidkdr

What is range of hemoglobin content in a animal like buffalo or cow?...

Political Science, 28.02.2020 12:10, Vanshikachilkoti10

Who is the present lok sabha speaker...

English, 28.02.2020 12:10, sandhu2840

What students learn from poem the person i am looking for?...

Chemistry, 28.02.2020 12:10, malikfaiz24

Ag+br2- 2agbr is an example of exothermic yes or no...

English, 28.02.2020 12:10, nitesh3786

One is odd in precarious unwavering unsteady wobbly...

Physics, 28.02.2020 12:10, jesuiskhushi

Three resistances of magnitude 2, 3 and 5 ohm are connected in parallel to a battery of 10 volts and of negligible resistance. the potential differenc...

Math, 28.02.2020 12:10, malikfaiz24

The digit at the test place of a two digit number is three times the digit at the ones place if the sum of the number and the number formed by reversi...

Physics, 28.02.2020 12:10, vinit3880

Work done by a turbine upon the weight of water flowing per second. a. depends b. does not depend...

Math, 28.02.2020 12:10, gyanendra19

Write the smallest numeral in the blank to make it divisible by 11? 439_71...

Math, 28.02.2020 12:10, tegery

Prove that in any triangle, the sum of the square of any two sides is equal to twice the square of half of the side together with twice the square of...

Science, 28.02.2020 12:10, lighy6155

What is meant by microbes ? what are their characterstics ?...

Chemistry, 28.02.2020 12:10, siya1472006

The solubility of copper sulphate 3o degree celcious is 24 what does mean...

Math, 28.02.2020 12:10, dnyandeepnile1999

Construct a 2 x 2 matrix, a = [aij], whose elements are given by:...

Math, 28.02.2020 12:10, kokaamy

Find the sum of 8,23,-32 -12 and -63...

English, 28.02.2020 12:10, Firdaus17f

Write a dairy of the day your brother got engaged...

English, 28.02.2020 12:10, rudru10

Character sketch of mr. anagnos...

India Languages, 28.02.2020 12:10, renukatumane109

Railway i ob k liye kya kare or kya qulificatin in 2019...

Physics, 28.02.2020 12:10, mohit81281

What will you do to find out boiling point of water ?...

Social Sciences, 28.02.2020 12:10, madhavirani24

What is the role played by political parties during an election...

Physics, 28.02.2020 12:10, faraaz62

On what factor does the acceleration of a body depends?...

Hindi, 28.02.2020 12:10, rudru10

What is heterogeneous hypodensity and meaning in ?...

Social Sciences, 28.02.2020 12:10, vijayrockzz4949

The mirror important questions 10 science light...

Science, 28.02.2020 12:10, Firdaus17f

How do organisms reproduced sexuality or sexuality maintain constant chromosomal no. through several generations explain with the of suitable example...

Social Sciences, 28.02.2020 12:10, bhavya1650

Name the indian sports shooter who finished 4th at the issf shotgun world cup final in rome. chatterjee gurpal singh mairaj a...

English, 28.02.2020 12:10, malikfaiz24

Describe collective money madness of people in the poem in the...

Physics, 28.02.2020 12:10, renukatumane109

Physics 0 the questions are why are alloya...

Biology, 28.02.2020 12:10, faraaz62

Natural selection is directing evolution in beetle population support with an example...

India Languages, 28.02.2020 12:10, malikfaiz24

Name the three names of any three folk dancers...

Geography, 28.02.2020 12:10, vanshsingh15

How can we say the earth is still active ?...

History, 28.02.2020 12:10, kokaamy

How did the forest acts change the life of pastoralists? explain.in 5 point...

Biology, 28.02.2020 12:10, divyanshu7571

Name the epithelium that forms lining of kidney tubules?...

Math, 28.02.2020 12:10, jesuiskhushi

Solve by competing square method x* + x - 20 equal to 0...

Science, 28.02.2020 12:10, kumarivishakha118

Name the micro organisms used in large production of alcohol...

Physics, 28.02.2020 12:10, Firdaus17f

The given graph shows the variation of photoelectric current (i) versus applied voltage (v) for two different photosensitive materials and for two dif...

Biology, 28.02.2020 12:10, hiraji

Area of the body seems to have the concentration of beneficial microbes...

Biology, 28.02.2020 12:10, chennupatitanuja

Ls 10 soil pollution and ls 11 bio geo chemical cycles...

Chemistry, 28.02.2020 12:10, eka85

Copper is represented by the symbol 'cu ' there is no letter 'u' in the name why...